C23H27N5O7S — CID 169330330
tert-butyl 4-[[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 169330330) has the molecular formula C23H27N5O7S and a molecular weight of 517.56 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169330330 |
| Molecular Formula | C23H27N5O7S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | tert-butyl 4-[[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)c2ccc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)cc2)CC1 |
| InChI | InChI=1S/C23H27N5O7S/c1-23(2,3)35-22(32)27-10-8-13(9-11-27)26-36(33,34)15-6-4-14(5-7-15)28-17(29)12-16-18(19(28)24)21(31)25-20(16)30/h4-7,12-13,26H,8-11,24H2,1-3H3,(H,25,30,31) |
| InChIKey | OQRRNJVPTKQKSU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 169.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|