C11H15NO3S — CID 61058879
3-(1,1-dioxothiolan-3-yl)oxy-4-methylaniline (PubChem CID 61058879) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)oxy-4-methylaniline.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)oxy-4-methylaniline |
|---|---|
| PubChem CID | 61058879 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)oxy-4-methylaniline |
| SMILES | Cc1ccc(N)cc1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15NO3S/c1-8-2-3-9(12)6-11(8)15-10-4-5-16(13,14)7-10/h2-3,6,10H,4-5,7,12H2,1H3 |
| InChIKey | KOMNZQQLRNRFDS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|