C12H16O3S — CID 83381393
3-(2,3-dimethylphenoxy)thiolane 1,1-dioxide (PubChem CID 83381393) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)thiolane 1,1-dioxide.
| Compound Name | 3-(2,3-dimethylphenoxy)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 83381393 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)thiolane 1,1-dioxide |
| SMILES | Cc1cccc(OC2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C12H16O3S/c1-9-4-3-5-12(10(9)2)15-11-6-7-16(13,14)8-11/h3-5,11H,6-8H2,1-2H3 |
| InChIKey | NIKWTKFXFIGLEF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |