C11H11ClO4S — CID 54914558
2-chloro-6-(1,1-dioxothiolan-3-yl)oxybenzaldehyde (PubChem CID 54914558) has the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. Its IUPAC name is 2-chloro-6-(1,1-dioxothiolan-3-yl)oxybenzaldehyde.
| Compound Name | 2-chloro-6-(1,1-dioxothiolan-3-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 54914558 |
| Molecular Formula | C11H11ClO4S |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 2-chloro-6-(1,1-dioxothiolan-3-yl)oxybenzaldehyde |
| SMILES | O=Cc1c(Cl)cccc1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H11ClO4S/c12-10-2-1-3-11(9(10)6-13)16-8-4-5-17(14,15)7-8/h1-3,6,8H,4-5,7H2 |
| InChIKey | BAFUVVCKXDWOJI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|