C14H14O3S — CID 62113334
3-naphthalen-1-yloxythiolane 1,1-dioxide (PubChem CID 62113334) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-naphthalen-1-yloxythiolane 1,1-dioxide.
| Compound Name | 3-naphthalen-1-yloxythiolane 1,1-dioxide |
|---|---|
| PubChem CID | 62113334 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-naphthalen-1-yloxythiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Oc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C14H14O3S/c15-18(16)9-8-12(10-18)17-14-7-3-5-11-4-1-2-6-13(11)14/h1-7,12H,8-10H2 |
| InChIKey | VANLKHLOJLXZIO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |