C15H14O5S — CID 61057124
3-(1,1-dioxothiolan-3-yl)oxynaphthalene-2-carboxylic acid (PubChem CID 61057124) has the molecular formula C15H14O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)oxynaphthalene-2-carboxylic acid.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)oxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 61057124 |
| Molecular Formula | C15H14O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)oxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2cc1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H14O5S/c16-15(17)13-7-10-3-1-2-4-11(10)8-14(13)20-12-5-6-21(18,19)9-12/h1-4,7-8,12H,5-6,9H2,(H,16,17) |
| InChIKey | PYYPSILGJOBWBS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |