C12H11F3O5S — CID 63320702
4-(1,1-dioxothiolan-3-yl)oxy-3-(trifluoromethyl)benzoic acid (PubChem CID 63320702) has the molecular formula C12H11F3O5S and a molecular weight of 324.28 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)oxy-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)oxy-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 63320702 |
| Molecular Formula | C12H11F3O5S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)oxy-3-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(OC2CCS(=O)(=O)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3O5S/c13-12(14,15)9-5-7(11(16)17)1-2-10(9)20-8-3-4-21(18,19)6-8/h1-2,5,8H,3-4,6H2,(H,16,17) |
| InChIKey | ZPKJSLOJAYGVDR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |