C12H13FO4S — CID 113389568
1-[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]ethanone (PubChem CID 113389568) has the molecular formula C12H13FO4S and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]ethanone.
| Compound Name | 1-[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 113389568 |
| Molecular Formula | C12H13FO4S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(OC2CCS(=O)(=O)C2)c(F)c1 |
| InChI | InChI=1S/C12H13FO4S/c1-8(14)9-2-3-12(11(13)6-9)17-10-4-5-18(15,16)7-10/h2-3,6,10H,4-5,7H2,1H3 |
| InChIKey | RYYXHKKHZAOTIG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |