C14H20FNO3S — CID 107687258
N-[[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]methyl]propan-1-amine (PubChem CID 107687258) has the molecular formula C14H20FNO3S and a molecular weight of 301.38 g/mol. Its IUPAC name is N-[[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107687258 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[[4-(1,1-dioxothiolan-3-yl)oxy-3-fluorophenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(OC2CCS(=O)(=O)C2)c(F)c1 |
| InChI | InChI=1S/C14H20FNO3S/c1-2-6-16-9-11-3-4-14(13(15)8-11)19-12-5-7-20(17,18)10-12/h3-4,8,12,16H,2,5-7,9-10H2,1H3 |
| InChIKey | DUPYGBHFRKBGMF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|