C14H21NO3S — CID 54914729
N-[[3-(1,1-dioxothiolan-3-yl)oxyphenyl]methyl]propan-1-amine (PubChem CID 54914729) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is N-[[3-(1,1-dioxothiolan-3-yl)oxyphenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-(1,1-dioxothiolan-3-yl)oxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 54914729 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[[3-(1,1-dioxothiolan-3-yl)oxyphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(OC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-2-7-15-10-12-4-3-5-13(9-12)18-14-6-8-19(16,17)11-14/h3-5,9,14-15H,2,6-8,10-11H2,1H3 |
| InChIKey | IYNAEFUGDLBWFD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|