4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid

C12H14O6S — CID 54914913

IUPAC4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid
SMILESCOc1cc(C(=O)O)ccc1OC1CCS(=O)(=O)C1
InChIInChI=1S/C12H14O6S/c1-17-11-6-8(12(13)14)2-3-10(11)18-9-4-5-19(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14)
InChIKeyFKNMIEFGCYNUSR-UHFFFAOYSA-N
MW286.31 g/mol
LogP0.96
Rot. Bonds4

About 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid

4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid (PubChem CID 54914913) has the molecular formula C12H14O6S and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid.

Molecular Properties

Compound Name4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid
PubChem CID54914913
Molecular FormulaC12H14O6S
Molecular Weight286.31 g/mol
Exact Mass286.05
IUPAC Name4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid
SMILESCOc1cc(C(=O)O)ccc1OC1CCS(=O)(=O)C1
InChIInChI=1S/C12H14O6S/c1-17-11-6-8(12(13)14)2-3-10(11)18-9-4-5-19(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14)
InChIKeyFKNMIEFGCYNUSR-UHFFFAOYSA-N
XLogP0.96
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.31
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid?
The IUPAC name of 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid (CID 54914913) is 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid.
What is the SMILES notation for 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid?
The canonical SMILES for 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid is COc1cc(C(=O)O)ccc1OC1CCS(=O)(=O)C1.
What is the InChIKey of 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid?
The InChIKey is FKNMIEFGCYNUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O6S/c1-17-11-6-8(12(13)14)2-3-10(11)18-9-4-5-19(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14).
What are the key properties of 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid?
4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid has a molecular weight of 286.31 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiolan-3-yl)oxy-3-methoxybenzoic acid is sourced from PubChem (CID 54914913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).