C15H19NO5 — CID 117473278
2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]-2-oxoacetic acid (PubChem CID 117473278) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]-2-oxoacetic acid.
| Compound Name | 2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117473278 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]-2-oxoacetic acid |
| SMILES | COc1cc(C(=O)C(=O)O)ccc1OC1CCN(C)CC1 |
| InChI | InChI=1S/C15H19NO5/c1-16-7-5-11(6-8-16)21-12-4-3-10(9-13(12)20-2)14(17)15(18)19/h3-4,9,11H,5-8H2,1-2H3,(H,18,19) |
| InChIKey | JDSNMZXVCLSQIF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|