C16H23NO5 — CID 117494142
methyl 2-hydroxy-2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]acetate (PubChem CID 117494142) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]acetate.
| Compound Name | methyl 2-hydroxy-2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]acetate |
|---|---|
| PubChem CID | 117494142 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl 2-hydroxy-2-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]acetate |
| SMILES | COC(=O)C(O)c1ccc(OC2CCN(C)CC2)c(OC)c1 |
| InChI | InChI=1S/C16H23NO5/c1-17-8-6-12(7-9-17)22-13-5-4-11(10-14(13)20-2)15(18)16(19)21-3/h4-5,10,12,15,18H,6-9H2,1-3H3 |
| InChIKey | LFAUPEMOENDJAF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |