C15H22ClNO4 — CID 2948697
(1-methylpiperidin-4-yl) 3,4-dimethoxybenzoate;hydrochloride (PubChem CID 2948697) has the molecular formula C15H22ClNO4 and a molecular weight of 315.80 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 3,4-dimethoxybenzoate;hydrochloride.
| Compound Name | (1-methylpiperidin-4-yl) 3,4-dimethoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 2948697 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (1-methylpiperidin-4-yl) 3,4-dimethoxybenzoate;hydrochloride |
| SMILES | COc1ccc(C(=O)OC2CCN(C)CC2)cc1OC.Cl |
| InChI | InChI=1S/C15H21NO4.ClH/c1-16-8-6-12(7-9-16)20-15(17)11-4-5-13(18-2)14(10-11)19-3;/h4-5,10,12H,6-9H2,1-3H3;1H |
| InChIKey | BQDLJZAJUUZAQR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |