C15H21NO4 — CID 905590
[(3S)-1-methylpiperidin-3-yl] 3,4-dimethoxybenzoate (PubChem CID 905590) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(3S)-1-methylpiperidin-3-yl] 3,4-dimethoxybenzoate.
| Compound Name | [(3S)-1-methylpiperidin-3-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 905590 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [(3S)-1-methylpiperidin-3-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2CCCN(C)C2)cc1OC |
| InChI | InChI=1S/C15H21NO4/c1-16-8-4-5-12(10-16)20-15(17)11-6-7-13(18-2)14(9-11)19-3/h6-7,9,12H,4-5,8,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | SXZSTOYRBQKQOM-LBPRGKRZSA-N |
| XLogP | 1.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |