C15H22NO4+ — CID 5114137
(1-methylpiperidin-1-ium-3-yl) 3,4-dimethoxybenzoate (PubChem CID 5114137) has the molecular formula C15H22NO4+ and a molecular weight of 280.34 g/mol. Its IUPAC name is (1-methylpiperidin-1-ium-3-yl) 3,4-dimethoxybenzoate.
| Compound Name | (1-methylpiperidin-1-ium-3-yl) 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 5114137 |
| Molecular Formula | C15H22NO4+ |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (1-methylpiperidin-1-ium-3-yl) 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OC2CCC[NH+](C)C2)cc1OC |
| InChI | InChI=1S/C15H21NO4/c1-16-8-4-5-12(10-16)20-15(17)11-6-7-13(18-2)14(9-11)19-3/h6-7,9,12H,4-5,8,10H2,1-3H3/p+1 |
| InChIKey | SXZSTOYRBQKQOM-UHFFFAOYSA-O |
| XLogP | 0.54 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |