C36H36O8 — CID 58512760
[3-(3-methoxy-4-phenylmethoxybenzoyl)oxycyclohexyl] 3-methoxy-4-phenylmethoxybenzoate (PubChem CID 58512760) has the molecular formula C36H36O8 and a molecular weight of 596.68 g/mol. Its IUPAC name is [3-(3-methoxy-4-phenylmethoxybenzoyl)oxycyclohexyl] 3-methoxy-4-phenylmethoxybenzoate.
| Compound Name | [3-(3-methoxy-4-phenylmethoxybenzoyl)oxycyclohexyl] 3-methoxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 58512760 |
| Molecular Formula | C36H36O8 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | [3-(3-methoxy-4-phenylmethoxybenzoyl)oxycyclohexyl] 3-methoxy-4-phenylmethoxybenzoate |
| SMILES | COc1cc(C(=O)OC2CCCC(OC(=O)c3ccc(OCc4ccccc4)c(OC)c3)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H36O8/c1-39-33-20-27(16-18-31(33)41-23-25-10-5-3-6-11-25)35(37)43-29-14-9-15-30(22-29)44-36(38)28-17-19-32(34(21-28)40-2)42-24-26-12-7-4-8-13-26/h3-8,10-13,16-21,29-30H,9,14-15,22-24H2,1-2H3 |
| InChIKey | UTTNYPAVCAZOII-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |