C23H20O7 — CID 144750223
[4-(4-methoxybenzoyl)oxyphenyl] 3,4-dimethoxybenzoate (PubChem CID 144750223) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is [4-(4-methoxybenzoyl)oxyphenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-(4-methoxybenzoyl)oxyphenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 144750223 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [4-(4-methoxybenzoyl)oxyphenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C23H20O7/c1-26-17-7-4-15(5-8-17)22(24)29-18-9-11-19(12-10-18)30-23(25)16-6-13-20(27-2)21(14-16)28-3/h4-14H,1-3H3 |
| InChIKey | OXIMBVLWZRCZMV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|