C34H34O8 — CID 3098065
[4-[2-[4-(3,4-dimethoxybenzoyl)oxyphenyl]butan-2-yl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 3098065) has the molecular formula C34H34O8 and a molecular weight of 570.64 g/mol. Its IUPAC name is [4-[2-[4-(3,4-dimethoxybenzoyl)oxyphenyl]butan-2-yl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-[2-[4-(3,4-dimethoxybenzoyl)oxyphenyl]butan-2-yl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3098065 |
| Molecular Formula | C34H34O8 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | [4-[2-[4-(3,4-dimethoxybenzoyl)oxyphenyl]butan-2-yl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | CCC(C)(c1ccc(OC(=O)c2ccc(OC)c(OC)c2)cc1)c1ccc(OC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C34H34O8/c1-7-34(2,24-10-14-26(15-11-24)41-32(35)22-8-18-28(37-3)30(20-22)39-5)25-12-16-27(17-13-25)42-33(36)23-9-19-29(38-4)31(21-23)40-6/h8-21H,7H2,1-6H3 |
| InChIKey | MJGKJQZXGYEJQJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|