About [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate
[4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate (PubChem CID 23012232) has the molecular formula C22H27BrO3
and a molecular weight of 419.36 g/mol. Its IUPAC name is [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate.
Molecular Properties
| Compound Name | [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate |
| PubChem CID | 23012232 |
| Molecular Formula | C22H27BrO3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(C(C)(C)CC)cc2)cc1Br |
| InChI | InChI=1S/C22H27BrO3/c1-5-7-14-25-20-13-8-16(15-19(20)23)21(24)26-18-11-9-17(10-12-18)22(3,4)6-2/h8-13,15H,5-7,14H2,1-4H3 |
| InChIKey | CGUSTIQRSNMNDL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate?
The IUPAC name of [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate (CID 23012232) is [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate.
What is the SMILES notation for [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate?
The canonical SMILES for [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate is CCCCOc1ccc(C(=O)Oc2ccc(C(C)(C)CC)cc2)cc1Br.
What is the InChIKey of [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate?
The InChIKey is CGUSTIQRSNMNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27BrO3/c1-5-7-14-25-20-13-8-16(15-19(20)23)21(24)26-18-11-9-17(10-12-18)22(3,4)6-2/h8-13,15H,5-7,14H2,1-4H3.
What are the key properties of [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate?
[4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate has a molecular weight of 419.36 g/mol, XLogP of 6.53, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methylbutan-2-yl)phenyl] 3-bromo-4-butoxybenzoate is sourced from PubChem (CID 23012232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).