C23H21NO6 — CID 19181553
[4-[(4-methoxyphenyl)carbamoyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 19181553) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)carbamoyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-[(4-methoxyphenyl)carbamoyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 19181553 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [4-[(4-methoxyphenyl)carbamoyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(NC(=O)c2ccc(OC(=O)c3ccc(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C23H21NO6/c1-27-18-11-7-17(8-12-18)24-22(25)15-4-9-19(10-5-15)30-23(26)16-6-13-20(28-2)21(14-16)29-3/h4-14H,1-3H3,(H,24,25) |
| InChIKey | WNEFHDONOFJZNN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|