C23H23NO7S — CID 71904208
[4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 3,4-dimethoxybenzoate (PubChem CID 71904208) has the molecular formula C23H23NO7S and a molecular weight of 457.50 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 71904208 |
| Molecular Formula | C23H23NO7S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)c3ccc(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C23H23NO7S/c1-24(32(26,27)20-12-10-18(28-2)11-13-20)17-6-8-19(9-7-17)31-23(25)16-5-14-21(29-3)22(15-16)30-4/h5-15H,1-4H3 |
| InChIKey | VHQAULGPDBDQND-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|