C22H21NO4S — CID 71904341
[4-[benzenesulfonyl(methyl)amino]phenyl] 3,4-dimethylbenzoate (PubChem CID 71904341) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is [4-[benzenesulfonyl(methyl)amino]phenyl] 3,4-dimethylbenzoate.
| Compound Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 71904341 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(N(C)S(=O)(=O)c3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C22H21NO4S/c1-16-9-10-18(15-17(16)2)22(24)27-20-13-11-19(12-14-20)23(3)28(25,26)21-7-5-4-6-8-21/h4-15H,1-3H3 |
| InChIKey | BKZOXZYGMCBBLM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|