C23H23NO4S — CID 2683510
(3,4-dimethylphenyl) 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2683510) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | (3,4-dimethylphenyl) 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2683510 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (3,4-dimethylphenyl) 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Oc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-4-24(20-8-6-5-7-9-20)29(26,27)22-14-11-19(12-15-22)23(25)28-21-13-10-17(2)18(3)16-21/h5-16H,4H2,1-3H3 |
| InChIKey | XZGNAJPTOLEVRC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|