C25H25NO5S — CID 2587922
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2587922) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2587922 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)O[C@@H](C)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25NO5S/c1-4-26(22-8-6-5-7-9-22)32(29,30)23-16-14-21(15-17-23)25(28)31-19(3)24(27)20-12-10-18(2)11-13-20/h5-17,19H,4H2,1-3H3/t19-/m0/s1 |
| InChIKey | VTJSBSQDMRAFJU-IBGZPJMESA-N |
| XLogP | 4.64 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |