C24H23NO5S — CID 2598698
[(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2598698) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2598698 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](C)OC(=O)c2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23NO5S/c1-17-9-11-19(12-10-17)23(26)18(2)30-24(27)20-13-15-22(16-14-20)31(28,29)25(3)21-7-5-4-6-8-21/h4-16,18H,1-3H3/t18-/m1/s1 |
| InChIKey | LDCPWCTZHWLBTN-GOSISDBHSA-N |
| XLogP | 4.25 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |