C25H26N2O7S — CID 4856047
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 4856047) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4856047 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C25H26N2O7S/c1-4-27(19-8-6-5-7-9-19)35(30,31)21-13-10-18(11-14-21)25(29)34-17-24(28)26-22-16-20(32-2)12-15-23(22)33-3/h5-16H,4,17H2,1-3H3,(H,26,28) |
| InChIKey | DLPUIUHPKYPBMI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |