C24H25NO4S — CID 71904195
[4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2,3-dimethylbenzoate (PubChem CID 71904195) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2,3-dimethylbenzoate.
| Compound Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 71904195 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2,3-dimethylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)c3cccc(C)c3C)cc2)cc1C |
| InChI | InChI=1S/C24H25NO4S/c1-16-9-14-22(15-18(16)3)30(27,28)25(5)20-10-12-21(13-11-20)29-24(26)23-8-6-7-17(2)19(23)4/h6-15H,1-5H3 |
| InChIKey | CKYYANKIGNRRQU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|