About (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate
(4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 2667235) has the molecular formula C21H18ClNO4S
and a molecular weight of 415.90 g/mol. Its IUPAC name is (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
| PubChem CID | 2667235 |
| Molecular Formula | C21H18ClNO4S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)Oc3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C21H18ClNO4S/c1-15-6-10-18(11-7-15)23(2)28(25,26)20-5-3-4-16(14-20)21(24)27-19-12-8-17(22)9-13-19/h3-14H,1-2H3 |
| InChIKey | ZQDGGOOTAREHFO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate?
The IUPAC name of (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate (CID 2667235) is (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate.
What is the SMILES notation for (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate?
The canonical SMILES for (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate is Cc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)Oc3ccc(Cl)cc3)c2)cc1.
What is the InChIKey of (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate?
The InChIKey is ZQDGGOOTAREHFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClNO4S/c1-15-6-10-18(11-7-15)23(2)28(25,26)20-5-3-4-16(14-20)21(24)27-19-12-8-17(22)9-13-19/h3-14H,1-2H3.
What are the key properties of (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate?
(4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate has a molecular weight of 415.90 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate is sourced from PubChem (CID 2667235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).