About (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate
(4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2577471) has the molecular formula C22H21NO4S
and a molecular weight of 395.48 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate |
| PubChem CID | 2577471 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(COC(=O)c2cccc(S(=O)(=O)N(C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H21NO4S/c1-17-11-13-18(14-12-17)16-27-22(24)19-7-6-10-21(15-19)28(25,26)23(2)20-8-4-3-5-9-20/h3-15H,16H2,1-2H3 |
| InChIKey | HGSLRTKIMUERRN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate?
The IUPAC name of (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate (CID 2577471) is (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate.
What is the SMILES notation for (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate?
The canonical SMILES for (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate is Cc1ccc(COC(=O)c2cccc(S(=O)(=O)N(C)c3ccccc3)c2)cc1.
What is the InChIKey of (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate?
The InChIKey is HGSLRTKIMUERRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO4S/c1-17-11-13-18(14-12-17)16-27-22(24)19-7-6-10-21(15-19)28(25,26)23(2)20-8-4-3-5-9-20/h3-15H,16H2,1-2H3.
What are the key properties of (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate?
(4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate has a molecular weight of 395.48 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate is sourced from PubChem (CID 2577471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).