C17H16ClNO4S — CID 27011553
2-chloroprop-2-enyl 3-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 27011553) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 3-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | 2-chloroprop-2-enyl 3-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 27011553 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-chloroprop-2-enyl 3-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | C=C(Cl)COC(=O)c1cccc(S(=O)(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C17H16ClNO4S/c1-13(18)12-23-17(20)14-7-6-10-16(11-14)24(21,22)19(2)15-8-4-3-5-9-15/h3-11H,1,12H2,2H3 |
| InChIKey | HLJPDIAKEPQICC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |