C20H22N2O5S — CID 2577860
(2-oxo-2-pyrrolidin-1-ylethyl) 3-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2577860) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 3-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 3-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2577860 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 3-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OCC(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H22N2O5S/c1-21(17-9-3-2-4-10-17)28(25,26)18-11-7-8-16(14-18)20(24)27-15-19(23)22-12-5-6-13-22/h2-4,7-11,14H,5-6,12-13,15H2,1H3 |
| InChIKey | ONNYGQHQCXBJBJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |