C19H18N2O4S2 — CID 2577675
(2-methyl-1,3-thiazol-4-yl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2577675) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | (2-methyl-1,3-thiazol-4-yl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2577675 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)methyl 3-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | Cc1nc(COC(=O)c2cccc(S(=O)(=O)N(C)c3ccccc3)c2)cs1 |
| InChI | InChI=1S/C19H18N2O4S2/c1-14-20-16(13-26-14)12-25-19(22)15-7-6-10-18(11-15)27(23,24)21(2)17-8-4-3-5-9-17/h3-11,13H,12H2,1-2H3 |
| InChIKey | NMGMABUFQNHXMQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |