C22H20FNO4S — CID 7923671
[4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-fluorobenzoate (PubChem CID 7923671) has the molecular formula C22H20FNO4S and a molecular weight of 413.47 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 7923671 |
| Molecular Formula | C22H20FNO4S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-fluorobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)c3ccccc3F)cc2)cc1C |
| InChI | InChI=1S/C22H20FNO4S/c1-15-8-13-19(14-16(15)2)29(26,27)24(3)17-9-11-18(12-10-17)28-22(25)20-6-4-5-7-21(20)23/h4-14H,1-3H3 |
| InChIKey | FHZAFBUSEHKYLZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|