C25H24N2O5S — CID 16550953
[4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-(4-cyanophenoxy)propanoate (PubChem CID 16550953) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-(4-cyanophenoxy)propanoate.
| Compound Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 16550953 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 2-(4-cyanophenoxy)propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)C(C)Oc3ccc(C#N)cc3)cc2)cc1C |
| InChI | InChI=1S/C25H24N2O5S/c1-17-5-14-24(15-18(17)2)33(29,30)27(4)21-8-12-23(13-9-21)32-25(28)19(3)31-22-10-6-20(16-26)7-11-22/h5-15,19H,1-4H3 |
| InChIKey | QYIIMWYYJQWBSS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|