C25H23N3O5S — CID 4813581
[4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 4813581) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 4813581 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)sulfonyl-methylamino]phenyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)c3nn(C)c(=O)c4ccccc34)cc2)cc1C |
| InChI | InChI=1S/C25H23N3O5S/c1-16-9-14-20(15-17(16)2)34(31,32)28(4)18-10-12-19(13-11-18)33-25(30)23-21-7-5-6-8-22(21)24(29)27(3)26-23/h5-15H,1-4H3 |
| InChIKey | JECKWALEEKAAKA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|