C20H20N4O6S — CID 16509771
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 16509771) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16509771 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2nn(C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H20N4O6S/c1-23(2)31(28,29)14-10-8-13(9-11-14)21-17(25)12-30-20(27)18-15-6-4-5-7-16(15)19(26)24(3)22-18/h4-11H,12H2,1-3H3,(H,21,25) |
| InChIKey | LKUDHTCWGGZVBZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |