C16H24ClNO5 — CID 44662663
(1-methylpiperidin-1-ium-4-yl) 3,4,5-trimethoxybenzoate chloride (PubChem CID 44662663) has the molecular formula C16H24ClNO5 and a molecular weight of 345.82 g/mol. Its IUPAC name is (1-methylpiperidin-1-ium-4-yl) 3,4,5-trimethoxybenzoate chloride.
| Compound Name | (1-methylpiperidin-1-ium-4-yl) 3,4,5-trimethoxybenzoate chloride |
|---|---|
| PubChem CID | 44662663 |
| Molecular Formula | C16H24ClNO5 |
| Molecular Weight | 345.82 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (1-methylpiperidin-1-ium-4-yl) 3,4,5-trimethoxybenzoate chloride |
| SMILES | COc1cc(C(=O)OC2CC[NH+](C)CC2)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C16H23NO5.ClH/c1-17-7-5-12(6-8-17)22-16(18)11-9-13(19-2)15(21-4)14(10-11)20-3;/h9-10,12H,5-8H2,1-4H3;1H |
| InChIKey | SKJRZXWJRHREEE-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.82 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |