C17H26ClNO5 — CID 154769621
(1-tert-butylazetidin-3-yl) 3,4,5-trimethoxybenzoate;hydrochloride (PubChem CID 154769621) has the molecular formula C17H26ClNO5 and a molecular weight of 359.85 g/mol. Its IUPAC name is (1-tert-butylazetidin-3-yl) 3,4,5-trimethoxybenzoate;hydrochloride.
| Compound Name | (1-tert-butylazetidin-3-yl) 3,4,5-trimethoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 154769621 |
| Molecular Formula | C17H26ClNO5 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (1-tert-butylazetidin-3-yl) 3,4,5-trimethoxybenzoate;hydrochloride |
| SMILES | COc1cc(C(=O)OC2CN(C(C)(C)C)C2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C17H25NO5.ClH/c1-17(2,3)18-9-12(10-18)23-16(19)11-7-13(20-4)15(22-6)14(8-11)21-5;/h7-8,12H,9-10H2,1-6H3;1H |
| InChIKey | GYVGMGHUVYVCBB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |