C17H24NO5+ — CID 7630514
[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl] 3,4,5-trimethoxybenzoate (PubChem CID 7630514) has the molecular formula C17H24NO5+ and a molecular weight of 322.38 g/mol. Its IUPAC name is [(3S)-1-azoniabicyclo[2.2.2]octan-3-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(3S)-1-azoniabicyclo[2.2.2]octan-3-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 7630514 |
| Molecular Formula | C17H24NO5+ |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(3S)-1-azoniabicyclo[2.2.2]octan-3-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@@H]2C[NH+]3CCC2CC3)cc(OC)c1OC |
| InChI | InChI=1S/C17H23NO5/c1-20-13-8-12(9-14(21-2)16(13)22-3)17(19)23-15-10-18-6-4-11(15)5-7-18/h8-9,11,15H,4-7,10H2,1-3H3/p+1/t15-/m1/s1 |
| InChIKey | QTZICPYJFRDZEN-OAHLLOKOSA-O |
| XLogP | 0.55 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |