C15H20NO3+ — CID 3637197
1-azoniabicyclo[2.2.2]octan-3-yl 4-methoxybenzoate (PubChem CID 3637197) has the molecular formula C15H20NO3+ and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-azoniabicyclo[2.2.2]octan-3-yl 4-methoxybenzoate.
| Compound Name | 1-azoniabicyclo[2.2.2]octan-3-yl 4-methoxybenzoate |
|---|---|
| PubChem CID | 3637197 |
| Molecular Formula | C15H20NO3+ |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-azoniabicyclo[2.2.2]octan-3-yl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC2C[NH+]3CCC2CC3)cc1 |
| InChI | InChI=1S/C15H19NO3/c1-18-13-4-2-12(3-5-13)15(17)19-14-10-16-8-6-11(14)7-9-16/h2-5,11,14H,6-10H2,1H3/p+1 |
| InChIKey | RTVDYLNYUUQEKN-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |