C24H22O9 — CID 59583993
[6-(4-prop-2-enoyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate (PubChem CID 59583993) has the molecular formula C24H22O9 and a molecular weight of 454.43 g/mol. Its IUPAC name is [6-(4-prop-2-enoyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate.
| Compound Name | [6-(4-prop-2-enoyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 59583993 |
| Molecular Formula | C24H22O9 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [6-(4-prop-2-enoyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate |
| SMILES | C=CC(=O)Oc1ccc(C(=O)OC2COC3C(OC(=O)c4ccc(OC)cc4)COC23)cc1 |
| InChI | InChI=1S/C24H22O9/c1-3-20(25)31-17-10-6-15(7-11-17)24(27)33-19-13-30-21-18(12-29-22(19)21)32-23(26)14-4-8-16(28-2)9-5-14/h3-11,18-19,21-22H,1,12-13H2,2H3 |
| InChIKey | KJNPQYIUSIKTAE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|