C21H20O7 — CID 155032219
[4-[[(6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methoxybenzoate (PubChem CID 155032219) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is [4-[[(6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[[(6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 155032219 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [4-[[(6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)OC3COC4CCO[C@@H]43)cc2)cc1 |
| InChI | InChI=1S/C21H20O7/c1-24-15-6-2-13(3-7-15)20(22)27-16-8-4-14(5-9-16)21(23)28-18-12-26-17-10-11-25-19(17)18/h2-9,17-19H,10-12H2,1H3/t17?,18?,19-/m0/s1 |
| InChIKey | IDQNGRLJWVIBNW-ACBHZAAOSA-N |
| XLogP | 2.63 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|