C27H28O9 — CID 142857398
[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-hex-5-enoxycarbonyloxybenzoyl)oxybenzoate (PubChem CID 142857398) has the molecular formula C27H28O9 and a molecular weight of 496.51 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-hex-5-enoxycarbonyloxybenzoyl)oxybenzoate.
| Compound Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-hex-5-enoxycarbonyloxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 142857398 |
| Molecular Formula | C27H28O9 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-hex-5-enoxycarbonyloxybenzoyl)oxybenzoate |
| SMILES | C=CCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)OC3CO[C@@H]4CCO[C@H]34)cc2)cc1 |
| InChI | InChI=1S/C27H28O9/c1-2-3-4-5-15-32-27(30)35-21-12-8-18(9-13-21)25(28)34-20-10-6-19(7-11-20)26(29)36-23-17-33-22-14-16-31-24(22)23/h2,6-13,22-24H,1,3-5,14-17H2/t22-,23?,24+/m1/s1 |
| InChIKey | VDJYMUXVBSIREX-BGTNVORWSA-N |
| XLogP | 4.49 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|