C23H22O9 — CID 134276333
[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-ethoxycarbonyloxybenzoyl)oxybenzoate (PubChem CID 134276333) has the molecular formula C23H22O9 and a molecular weight of 442.42 g/mol. Its IUPAC name is [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-ethoxycarbonyloxybenzoyl)oxybenzoate.
| Compound Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-ethoxycarbonyloxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 134276333 |
| Molecular Formula | C23H22O9 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-ethoxycarbonyloxybenzoyl)oxybenzoate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)O[C@@H]3CO[C@@H]4CCO[C@@H]43)cc2)cc1 |
| InChI | InChI=1S/C23H22O9/c1-2-27-23(26)31-17-9-5-14(6-10-17)21(24)30-16-7-3-15(4-8-16)22(25)32-19-13-29-18-11-12-28-20(18)19/h3-10,18-20H,2,11-13H2,1H3/t18-,19-,20+/m1/s1 |
| InChIKey | XONLRHNMEUMMLE-AQNXPRMDSA-N |
| XLogP | 3.15 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|