C23H22O8 — CID 89352781
[4-[[(3R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate (PubChem CID 89352781) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is [4-[[(3R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[[(3R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 89352781 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [4-[[(3R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate |
| SMILES | CC(=O)O[C@@H]1COC2C(OC(=O)c3ccc(OC(=O)c4ccc(C)cc4)cc3)COC21 |
| InChI | InChI=1S/C23H22O8/c1-13-3-5-15(6-4-13)22(25)30-17-9-7-16(8-10-17)23(26)31-19-12-28-20-18(29-14(2)24)11-27-21(19)20/h3-10,18-21H,11-12H2,1-2H3/t18-,19?,20?,21?/m1/s1 |
| InChIKey | CYQKIHHZNRWKTL-YXOXRFPUSA-N |
| XLogP | 2.47 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|