C36H30O10 — CID 118084023
[4-(4-methylbenzoyl)oxyphenyl] (3S,3aR,6R,6aS)-6-[4-(4-methylbenzoyl)oxybenzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-carboxylate (PubChem CID 118084023) has the molecular formula C36H30O10 and a molecular weight of 622.63 g/mol. Its IUPAC name is [4-(4-methylbenzoyl)oxyphenyl] (3S,3aR,6R,6aS)-6-[4-(4-methylbenzoyl)oxybenzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-carboxylate.
| Compound Name | [4-(4-methylbenzoyl)oxyphenyl] (3S,3aR,6R,6aS)-6-[4-(4-methylbenzoyl)oxybenzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-carboxylate |
|---|---|
| PubChem CID | 118084023 |
| Molecular Formula | C36H30O10 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | [4-(4-methylbenzoyl)oxyphenyl] (3S,3aR,6R,6aS)-6-[4-(4-methylbenzoyl)oxybenzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-carboxylate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(OC(=O)[C@H]3CO[C@H]4[C@@H]3OC[C@H]4OC(=O)c3ccc(OC(=O)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H30O10/c1-21-3-7-23(8-4-21)33(37)43-26-13-11-25(12-14-26)35(39)46-30-20-42-31-29(19-41-32(30)31)36(40)45-28-17-15-27(16-18-28)44-34(38)24-9-5-22(2)6-10-24/h3-18,29-32H,19-20H2,1-2H3/t29-,30+,31+,32+/m0/s1 |
| InChIKey | GAKNPBYAVYGGIW-SYEZAVJTSA-N |
| XLogP | 5.29 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|