C36H34O10 — CID 20645979
[4-[[6-[[4-[(4-methylphenyl)methylperoxy]phenyl]methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonyl]phenyl] 4-methylbenzoate (PubChem CID 20645979) has the molecular formula C36H34O10 and a molecular weight of 626.66 g/mol. Its IUPAC name is [4-[[6-[[4-[(4-methylphenyl)methylperoxy]phenyl]methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[[6-[[4-[(4-methylphenyl)methylperoxy]phenyl]methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 20645979 |
| Molecular Formula | C36H34O10 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | [4-[[6-[[4-[(4-methylphenyl)methylperoxy]phenyl]methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxycarbonyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(COOc2ccc(COOC3COC4C(OC(=O)c5ccc(OC(=O)c6ccc(C)cc6)cc5)COC34)cc2)cc1 |
| InChI | InChI=1S/C36H34O10/c1-23-3-7-25(8-4-23)19-41-45-30-15-9-26(10-16-30)20-42-46-32-22-40-33-31(21-39-34(32)33)44-36(38)28-13-17-29(18-14-28)43-35(37)27-11-5-24(2)6-12-27/h3-18,31-34H,19-22H2,1-2H3 |
| InChIKey | PDSYZKYCCDDTKS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|