C22H22O6 — CID 58960602
[4-[[(3S,6S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate (PubChem CID 58960602) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is [4-[[(3S,6S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[[(3S,6S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 58960602 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [4-[[(3S,6S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)O[C@H]3COC4C3OC[C@@H]4C)cc2)cc1 |
| InChI | InChI=1S/C22H22O6/c1-13-3-5-15(6-4-13)21(23)27-17-9-7-16(8-10-17)22(24)28-18-12-26-19-14(2)11-25-20(18)19/h3-10,14,18-20H,11-12H2,1-2H3/t14-,18-,19?,20?/m0/s1 |
| InChIKey | CEYYUFPTVIRTPT-RSAJEKCLSA-N |
| XLogP | 3.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|