C16H18O6 — CID 154593408
1-O-methyl 4-O-(3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) benzene-1,4-dicarboxylate (PubChem CID 154593408) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 1-O-methyl 4-O-(3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-methyl 4-O-(3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 154593408 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-O-methyl 4-O-(3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC2COC3C(C)COC23)cc1 |
| InChI | InChI=1S/C16H18O6/c1-9-7-20-14-12(8-21-13(9)14)22-16(18)11-5-3-10(4-6-11)15(17)19-2/h3-6,9,12-14H,7-8H2,1-2H3 |
| InChIKey | MIUPIXIIMHRMNS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |